C26H28N2O7S — CID 44640141
[2-(2-adamantylamino)-2-oxo-1-phenylethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 44640141) has the molecular formula C26H28N2O7S and a molecular weight of 512.58 g/mol. Its IUPAC name is [2-(2-adamantylamino)-2-oxo-1-phenylethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-(2-adamantylamino)-2-oxo-1-phenylethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 44640141 |
| Molecular Formula | C26H28N2O7S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | [2-(2-adamantylamino)-2-oxo-1-phenylethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OC(C(=O)NC2C3CC4CC(C3)CC2C4)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H28N2O7S/c1-36(33,34)22-8-7-18(14-21(22)28(31)32)26(30)35-24(17-5-3-2-4-6-17)25(29)27-23-19-10-15-9-16(12-19)13-20(23)11-15/h2-8,14-16,19-20,23-24H,9-13H2,1H3,(H,27,29) |
| InChIKey | QKWZASKYUXKQSZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|