C25H36ClNO2 — CID 44654845
1-(4-pentoxyphenyl)-2-phenyl-3-piperidin-1-ium-1-ylpropan-1-ol chloride (PubChem CID 44654845) has the molecular formula C25H36ClNO2 and a molecular weight of 418.02 g/mol. Its IUPAC name is 1-(4-pentoxyphenyl)-2-phenyl-3-piperidin-1-ium-1-ylpropan-1-ol chloride.
| Compound Name | 1-(4-pentoxyphenyl)-2-phenyl-3-piperidin-1-ium-1-ylpropan-1-ol chloride |
|---|---|
| PubChem CID | 44654845 |
| Molecular Formula | C25H36ClNO2 |
| Molecular Weight | 418.02 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-(4-pentoxyphenyl)-2-phenyl-3-piperidin-1-ium-1-ylpropan-1-ol chloride |
| SMILES | CCCCCOc1ccc(C(O)C(C[NH+]2CCCCC2)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C25H35NO2.ClH/c1-2-3-10-19-28-23-15-13-22(14-16-23)25(27)24(21-11-6-4-7-12-21)20-26-17-8-5-9-18-26;/h4,6-7,11-16,24-25,27H,2-3,5,8-10,17-20H2,1H3;1H |
| InChIKey | QJYBAEPZLLWZPX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.02 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|