C23H32NO3+ — CID 7336125
(1R,2S)-1-(4-butoxyphenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-ol (PubChem CID 7336125) has the molecular formula C23H32NO3+ and a molecular weight of 370.51 g/mol. Its IUPAC name is (1R,2S)-1-(4-butoxyphenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-ol.
| Compound Name | (1R,2S)-1-(4-butoxyphenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-ol |
|---|---|
| PubChem CID | 7336125 |
| Molecular Formula | C23H32NO3+ |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (1R,2S)-1-(4-butoxyphenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-ol |
| SMILES | CCCCOc1ccc([C@H](O)[C@H](C[NH+]2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H31NO3/c1-2-3-15-27-21-11-9-20(10-12-21)23(25)22(19-7-5-4-6-8-19)18-24-13-16-26-17-14-24/h4-12,22-23,25H,2-3,13-18H2,1H3/p+1/t22-,23+/m1/s1 |
| InChIKey | AFMFNWNIOFULQN-PKTZIBPZSA-O |
| XLogP | 2.60 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|