C23H32NO3+ — CID 4067318
3-(4-methoxyphenyl)-1-morpholin-4-ium-4-yl-2-phenylhexan-3-ol (PubChem CID 4067318) has the molecular formula C23H32NO3+ and a molecular weight of 370.51 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-morpholin-4-ium-4-yl-2-phenylhexan-3-ol.
| Compound Name | 3-(4-methoxyphenyl)-1-morpholin-4-ium-4-yl-2-phenylhexan-3-ol |
|---|---|
| PubChem CID | 4067318 |
| Molecular Formula | C23H32NO3+ |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-morpholin-4-ium-4-yl-2-phenylhexan-3-ol |
| SMILES | CCCC(O)(c1ccc(OC)cc1)C(C[NH+]1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO3/c1-3-13-23(25,20-9-11-21(26-2)12-10-20)22(19-7-5-4-6-8-19)18-24-14-16-27-17-15-24/h4-12,22,25H,3,13-18H2,1-2H3/p+1 |
| InChIKey | MCPXRMSANKDTNK-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |