C22H32NO2+ — CID 5189560
[3-(4-ethoxyphenyl)-3-hydroxy-2-phenylhexyl]-dimethylazanium (PubChem CID 5189560) has the molecular formula C22H32NO2+ and a molecular weight of 342.50 g/mol. Its IUPAC name is [3-(4-ethoxyphenyl)-3-hydroxy-2-phenylhexyl]-dimethylazanium.
| Compound Name | [3-(4-ethoxyphenyl)-3-hydroxy-2-phenylhexyl]-dimethylazanium |
|---|---|
| PubChem CID | 5189560 |
| Molecular Formula | C22H32NO2+ |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | [3-(4-ethoxyphenyl)-3-hydroxy-2-phenylhexyl]-dimethylazanium |
| SMILES | CCCC(O)(c1ccc(OCC)cc1)C(C[NH+](C)C)c1ccccc1 |
| InChI | InChI=1S/C22H31NO2/c1-5-16-22(24,19-12-14-20(15-13-19)25-6-2)21(17-23(3)4)18-10-8-7-9-11-18/h7-15,21,24H,5-6,16-17H2,1-4H3/p+1 |
| InChIKey | LVFVTRRIQKJDGL-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |