C25H36NO2+ — CID 6961243
(1R,2R)-1-[4-(3-methylbutoxy)phenyl]-2-phenyl-3-piperidin-1-ium-1-ylpropan-1-ol (PubChem CID 6961243) has the molecular formula C25H36NO2+ and a molecular weight of 382.57 g/mol. Its IUPAC name is (1R,2R)-1-[4-(3-methylbutoxy)phenyl]-2-phenyl-3-piperidin-1-ium-1-ylpropan-1-ol.
| Compound Name | (1R,2R)-1-[4-(3-methylbutoxy)phenyl]-2-phenyl-3-piperidin-1-ium-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 6961243 |
| Molecular Formula | C25H36NO2+ |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (1R,2R)-1-[4-(3-methylbutoxy)phenyl]-2-phenyl-3-piperidin-1-ium-1-ylpropan-1-ol |
| SMILES | CC(C)CCOc1ccc([C@H](O)[C@@H](C[NH+]2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H35NO2/c1-20(2)15-18-28-23-13-11-22(12-14-23)25(27)24(21-9-5-3-6-10-21)19-26-16-7-4-8-17-26/h3,5-6,9-14,20,24-25,27H,4,7-8,15-19H2,1-2H3/p+1/t24-,25-/m0/s1 |
| InChIKey | BVFZXSGNFKRJJA-DQEYMECFSA-O |
| XLogP | 4.00 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |