C13H17IN2 — CID 44655304
2-ethyl-1,3-dimethylquinolin-1-ium-4-amine iodide (PubChem CID 44655304) has the molecular formula C13H17IN2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 2-ethyl-1,3-dimethylquinolin-1-ium-4-amine iodide.
| Compound Name | 2-ethyl-1,3-dimethylquinolin-1-ium-4-amine iodide |
|---|---|
| PubChem CID | 44655304 |
| Molecular Formula | C13H17IN2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-ethyl-1,3-dimethylquinolin-1-ium-4-amine iodide |
| SMILES | CCc1c(C)c(N)c2ccccc2[n+]1C.[I-] |
| InChI | InChI=1S/C13H16N2.HI/c1-4-11-9(2)13(14)10-7-5-6-8-12(10)15(11)3;/h5-8,14H,4H2,1-3H3;1H |
| InChIKey | QLBHRFZAHMGRHU-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|