C16H17N2+ — CID 158717948
3-ethyl-2,4-dimethylbenzo[g]quinoxalin-4-ium (PubChem CID 158717948) has the molecular formula C16H17N2+ and a molecular weight of 237.33 g/mol. Its IUPAC name is 3-ethyl-2,4-dimethylbenzo[g]quinoxalin-4-ium.
| Compound Name | 3-ethyl-2,4-dimethylbenzo[g]quinoxalin-4-ium |
|---|---|
| PubChem CID | 158717948 |
| Molecular Formula | C16H17N2+ |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 3-ethyl-2,4-dimethylbenzo[g]quinoxalin-4-ium |
| SMILES | CCc1c(C)nc2cc3ccccc3cc2[n+]1C |
| InChI | InChI=1S/C16H17N2/c1-4-15-11(2)17-14-9-12-7-5-6-8-13(12)10-16(14)18(15)3/h5-10H,4H2,1-3H3/q+1 |
| InChIKey | KQHGMOPSJYWZDT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|