C26H37N3O3S — CID 44655811
(3R,5S)-3-azido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene;4-methylbenzenesulfonic acid (PubChem CID 44655811) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is (3R,5S)-3-azido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene;4-methylbenzenesulfonic acid.
| Compound Name | (3R,5S)-3-azido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 44655811 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | (3R,5S)-3-azido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene;4-methylbenzenesulfonic acid |
| SMILES | CC12C=CCC1C1CC[C@H]3C[C@H](N=[N+]=[N-])CCC3(C)C1CC2.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H29N3.C7H8O3S/c1-18-9-3-4-16(18)15-6-5-13-12-14(21-22-20)7-11-19(13,2)17(15)8-10-18;1-6-2-4-7(5-3-6)11(8,9)10/h3,9,13-17H,4-8,10-12H2,1-2H3;2-5H,1H3,(H,8,9,10)/t13-,14+,15?,16?,17?,18?,19?;/m0./s1 |
| InChIKey | VACADROYZURMKS-WQZBUAFRSA-N |
| XLogP | 7.12 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|