About sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate
sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate (PubChem CID 44660362) has the molecular formula C17H17ClNNaO6
and a molecular weight of 389.77 g/mol. Its IUPAC name is sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate.
Molecular Properties
| Compound Name | sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate |
| PubChem CID | 44660362 |
| Molecular Formula | C17H17ClNNaO6 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate |
| SMILES | CC(=O)c1c(-c2ccc(Cl)cc2)cc2ccc(C(=O)[O-])cn12.O.O.O.[Na+] |
| InChI | InChI=1S/C17H12ClNO3.Na.3H2O/c1-10(20)16-15(11-2-5-13(18)6-3-11)8-14-7-4-12(17(21)22)9-19(14)16;;;;/h2-9H,1H3,(H,21,22);;3*1H2/q;+1;;;/p-1 |
| InChIKey | YEKCJCIFFMZMCW-UHFFFAOYSA-M |
| XLogP | -2.64 |
| TPSA | 156.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate?
The IUPAC name of sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate (CID 44660362) is sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate.
What is the SMILES notation for sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate?
The canonical SMILES for sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate is CC(=O)c1c(-c2ccc(Cl)cc2)cc2ccc(C(=O)[O-])cn12.O.O.O.[Na+].
What is the InChIKey of sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate?
The InChIKey is YEKCJCIFFMZMCW-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H12ClNO3.Na.3H2O/c1-10(20)16-15(11-2-5-13(18)6-3-11)8-14-7-4-12(17(21)22)9-19(14)16;;;;/h2-9H,1H3,(H,21,22);;3*1H2/q;+1;;;/p-1.
What are the key properties of sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate?
sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate has a molecular weight of 389.77 g/mol, XLogP of -2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-acetyl-2-(4-chlorophenyl)indolizine-6-carboxylate;trihydrate is sourced from PubChem (CID 44660362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).