About sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate
sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate (PubChem CID 44655568) has the molecular formula C22H16NNaO4
and a molecular weight of 381.36 g/mol. Its IUPAC name is sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate.
Molecular Properties
| Compound Name | sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate |
| PubChem CID | 44655568 |
| Molecular Formula | C22H16NNaO4 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate |
| SMILES | O.O=C([O-])c1ccc2cc(-c3ccccc3)c(C(=O)c3ccccc3)n2c1.[Na+] |
| InChI | InChI=1S/C22H15NO3.Na.H2O/c24-21(16-9-5-2-6-10-16)20-19(15-7-3-1-4-8-15)13-18-12-11-17(22(25)26)14-23(18)20;;/h1-14H,(H,25,26);;1H2/q;+1;/p-1 |
| InChIKey | SYLPJVMBSFNXCF-UHFFFAOYSA-M |
| XLogP | -0.62 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate?
The IUPAC name of sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate (CID 44655568) is sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate.
What is the SMILES notation for sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate?
The canonical SMILES for sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate is O.O=C([O-])c1ccc2cc(-c3ccccc3)c(C(=O)c3ccccc3)n2c1.[Na+].
What is the InChIKey of sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate?
The InChIKey is SYLPJVMBSFNXCF-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H15NO3.Na.H2O/c24-21(16-9-5-2-6-10-16)20-19(15-7-3-1-4-8-15)13-18-12-11-17(22(25)26)14-23(18)20;;/h1-14H,(H,25,26);;1H2/q;+1;/p-1.
What are the key properties of sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate?
sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate has a molecular weight of 381.36 g/mol, XLogP of -0.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-benzoyl-2-phenylindolizine-6-carboxylate;hydrate is sourced from PubChem (CID 44655568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).