C30H38N2O9 — CID 44666155
3-(1H-indol-3-yl)-2-[[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]propanoic acid (PubChem CID 44666155) has the molecular formula C30H38N2O9 and a molecular weight of 570.64 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-[[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-[[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 44666155 |
| Molecular Formula | C30H38N2O9 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-[[4-oxo-4-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoyl]amino]propanoic acid |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@H](OC(=O)CCC(=O)NC(Cc3c[nH]c4ccccc34)C(=O)O)O[C@@H]3O[C@]4(C)CC[C@@H]1C23OO4 |
| InChI | InChI=1S/C30H38N2O9/c1-16-8-9-21-17(2)27(38-28-30(21)20(16)12-13-29(3,39-28)40-41-30)37-25(34)11-10-24(33)32-23(26(35)36)14-18-15-31-22-7-5-4-6-19(18)22/h4-7,15-17,20-21,23,27-28,31H,8-14H2,1-3H3,(H,32,33)(H,35,36)/t16-,17-,20+,21?,23?,27-,28-,29+,30?/m1/s1 |
| InChIKey | AATOFHZSNWXOOT-IXEMQWAPSA-N |
| XLogP | 3.81 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|