C11H18O5 — CID 44719214
3-(2,5-dimethoxy-2H-furan-5-yl)propyl acetate (PubChem CID 44719214) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-(2,5-dimethoxy-2H-furan-5-yl)propyl acetate.
| Compound Name | 3-(2,5-dimethoxy-2H-furan-5-yl)propyl acetate |
|---|---|
| PubChem CID | 44719214 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-(2,5-dimethoxy-2H-furan-5-yl)propyl acetate |
| SMILES | COC1C=CC(CCCOC(C)=O)(OC)O1 |
| InChI | InChI=1S/C11H18O5/c1-9(12)15-8-4-6-11(14-3)7-5-10(13-2)16-11/h5,7,10H,4,6,8H2,1-3H3 |
| InChIKey | USOUEUFUGPMUSU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|