C9H14O4 — CID 44720274
2,7-dimethoxy-1,6-dioxaspiro[4.4]non-3-ene (PubChem CID 44720274) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 2,7-dimethoxy-1,6-dioxaspiro[4.4]non-3-ene.
| Compound Name | 2,7-dimethoxy-1,6-dioxaspiro[4.4]non-3-ene |
|---|---|
| PubChem CID | 44720274 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2,7-dimethoxy-1,6-dioxaspiro[4.4]non-3-ene |
| SMILES | COC1C=CC2(CCC(OC)O2)O1 |
| InChI | InChI=1S/C9H14O4/c1-10-7-3-5-9(12-7)6-4-8(11-2)13-9/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | YCMKOJGYBMFLQQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|