C12H21NO — CID 44719969
4-(furan-2-yl)-N,5-dimethylhexan-2-amine (PubChem CID 44719969) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-(furan-2-yl)-N,5-dimethylhexan-2-amine.
| Compound Name | 4-(furan-2-yl)-N,5-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 44719969 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-(furan-2-yl)-N,5-dimethylhexan-2-amine |
| SMILES | CNC(C)CC(c1ccco1)C(C)C |
| InChI | InChI=1S/C12H21NO/c1-9(2)11(8-10(3)13-4)12-6-5-7-14-12/h5-7,9-11,13H,8H2,1-4H3 |
| InChIKey | GWCWYSCEKWLREP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |