C14H17F3N2O2S — CID 44756391
1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 44756391) has the molecular formula C14H17F3N2O2S and a molecular weight of 334.36 g/mol. Its IUPAC name is 1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 44756391 |
| Molecular Formula | C14H17F3N2O2S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC1(C)OCC(CNC(=S)Nc2cccc(C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C14H17F3N2O2S/c1-13(2)20-8-11(21-13)7-18-12(22)19-10-5-3-4-9(6-10)14(15,16)17/h3-6,11H,7-8H2,1-2H3,(H2,18,19,22) |
| InChIKey | KGNFFZUYYWYDOB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|