C18H23Cl2N3O — CID 44784238
6,13-dimethyl-8-phenyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene;hydrate;dihydrochloride (PubChem CID 44784238) has the molecular formula C18H23Cl2N3O and a molecular weight of 368.31 g/mol. Its IUPAC name is 6,13-dimethyl-8-phenyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene;hydrate;dihydrochloride.
| Compound Name | 6,13-dimethyl-8-phenyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene;hydrate;dihydrochloride |
|---|---|
| PubChem CID | 44784238 |
| Molecular Formula | C18H23Cl2N3O |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 6,13-dimethyl-8-phenyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene;hydrate;dihydrochloride |
| SMILES | Cc1ccnc2c1c1c(n2-c2ccccc2)C(C)NCC1.Cl.Cl.O |
| InChI | InChI=1S/C18H19N3.2ClH.H2O/c1-12-8-10-20-18-16(12)15-9-11-19-13(2)17(15)21(18)14-6-4-3-5-7-14;;;/h3-8,10,13,19H,9,11H2,1-2H3;2*1H;1H2 |
| InChIKey | DTDRJEKNBOHOPD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |