C22H24N2O4 — CID 44817431
(1Z)-1-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-6,7-dimethoxy-4H-isoquinoline (PubChem CID 44817431) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (1Z)-1-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-6,7-dimethoxy-4H-isoquinoline.
| Compound Name | (1Z)-1-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-6,7-dimethoxy-4H-isoquinoline |
|---|---|
| PubChem CID | 44817431 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (1Z)-1-(6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-6,7-dimethoxy-4H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)/C(=C1/NCCc3cc(OC)c(OC)cc31)N=CC2 |
| InChI | InChI=1S/C22H24N2O4/c1-25-17-9-13-5-7-23-21(15(13)11-19(17)27-3)22-16-12-20(28-4)18(26-2)10-14(16)6-8-24-22/h7,9-12,24H,5-6,8H2,1-4H3/b22-21- |
| InChIKey | AADCAUGPROLKOI-DQRAZIAOSA-N |
| XLogP | 3.32 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|