C41H50ClN3O8 — CID 44828542
[2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-chloro-1-(4-methoxyphenyl)-1-oxotridecan-6-yl] 3-anilino-3-oxopropanoate (PubChem CID 44828542) has the molecular formula C41H50ClN3O8 and a molecular weight of 748.32 g/mol. Its IUPAC name is [2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-chloro-1-(4-methoxyphenyl)-1-oxotridecan-6-yl] 3-anilino-3-oxopropanoate.
| Compound Name | [2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-chloro-1-(4-methoxyphenyl)-1-oxotridecan-6-yl] 3-anilino-3-oxopropanoate |
|---|---|
| PubChem CID | 44828542 |
| Molecular Formula | C41H50ClN3O8 |
| Molecular Weight | 748.32 g/mol |
| Exact Mass | 747.33 |
| IUPAC Name | [2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-chloro-1-(4-methoxyphenyl)-1-oxotridecan-6-yl] 3-anilino-3-oxopropanoate |
| SMILES | CCCCCCCC(CCC(Cl)C(C(=O)c1ccc(OC)cc1)N1C(=O)C(OCC)N(Cc2ccccc2)C1=O)OC(=O)CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C41H50ClN3O8/c1-4-6-7-8-15-20-33(53-36(47)27-35(46)43-31-18-13-10-14-19-31)25-26-34(42)37(38(48)30-21-23-32(51-3)24-22-30)45-39(49)40(52-5-2)44(41(45)50)28-29-16-11-9-12-17-29/h9-14,16-19,21-24,33-34,37,40H,4-8,15,20,25-28H2,1-3H3,(H,43,46) |
| InChIKey | LLEJODSORPXJTJ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.32 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|