C7H11IN2 — CID 44887181
N,1-dimethylpyridin-1-ium-3-amine iodide (PubChem CID 44887181) has the molecular formula C7H11IN2 and a molecular weight of 250.08 g/mol. Its IUPAC name is N,1-dimethylpyridin-1-ium-3-amine iodide.
| Compound Name | N,1-dimethylpyridin-1-ium-3-amine iodide |
|---|---|
| PubChem CID | 44887181 |
| Molecular Formula | C7H11IN2 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | N,1-dimethylpyridin-1-ium-3-amine iodide |
| SMILES | CNc1ccc[n+](C)c1.[I-] |
| InChI | InChI=1S/C7H11N2.HI/c1-8-7-4-3-5-9(2)6-7;/h3-6,8H,1-2H3;1H/q+1;/p-1 |
| InChIKey | DVAPYOCIIWRGJT-UHFFFAOYSA-M |
| XLogP | -2.44 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|