C9H16N3+ — CID 154697359
1-(3-aminopropyl)-N-methylpyridin-1-ium-3-amine (PubChem CID 154697359) has the molecular formula C9H16N3+ and a molecular weight of 166.25 g/mol. Its IUPAC name is 1-(3-aminopropyl)-N-methylpyridin-1-ium-3-amine.
| Compound Name | 1-(3-aminopropyl)-N-methylpyridin-1-ium-3-amine |
|---|---|
| PubChem CID | 154697359 |
| Molecular Formula | C9H16N3+ |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.13 |
| IUPAC Name | 1-(3-aminopropyl)-N-methylpyridin-1-ium-3-amine |
| SMILES | CNc1ccc[n+](CCCN)c1 |
| InChI | InChI=1S/C9H16N3/c1-11-9-4-2-6-12(8-9)7-3-5-10/h2,4,6,8,11H,3,5,7,10H2,1H3/q+1 |
| InChIKey | MBPCRJNPOWNIRX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|