C8H15Br2N3 — CID 154697348
2-[3-(methylamino)pyridin-1-ium-1-yl]ethylazanium dibromide (PubChem CID 154697348) has the molecular formula C8H15Br2N3 and a molecular weight of 313.04 g/mol. Its IUPAC name is 2-[3-(methylamino)pyridin-1-ium-1-yl]ethylazanium dibromide.
| Compound Name | 2-[3-(methylamino)pyridin-1-ium-1-yl]ethylazanium dibromide |
|---|---|
| PubChem CID | 154697348 |
| Molecular Formula | C8H15Br2N3 |
| Molecular Weight | 313.04 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | 2-[3-(methylamino)pyridin-1-ium-1-yl]ethylazanium dibromide |
| SMILES | CNc1ccc[n+](CC[NH3+])c1.[Br-].[Br-] |
| InChI | InChI=1S/C8H14N3.2BrH/c1-10-8-3-2-5-11(7-8)6-4-9;;/h2-3,5,7,10H,4,6,9H2,1H3;2*1H/q+1;;/p-1 |
| InChIKey | JJNZMRZTMRLJCT-UHFFFAOYSA-M |
| XLogP | -6.73 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.04 |
| LogP ≤ 5 | -6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|