C10H13N2+ — CID 172854690
3-(3-ethynylpyridin-1-ium-1-yl)propan-1-amine (PubChem CID 172854690) has the molecular formula C10H13N2+ and a molecular weight of 161.23 g/mol. Its IUPAC name is 3-(3-ethynylpyridin-1-ium-1-yl)propan-1-amine.
| Compound Name | 3-(3-ethynylpyridin-1-ium-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 172854690 |
| Molecular Formula | C10H13N2+ |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 3-(3-ethynylpyridin-1-ium-1-yl)propan-1-amine |
| SMILES | C#Cc1ccc[n+](CCCN)c1 |
| InChI | InChI=1S/C10H13N2/c1-2-10-5-3-7-12(9-10)8-4-6-11/h1,3,5,7,9H,4,6,8,11H2/q+1 |
| InChIKey | INRJHMIULFICID-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|