C30H23BF4O2 — CID 44888324
2,4-diphenyl-6-(2-phenylmethoxyphenyl)pyrylium tetrafluoroborate (PubChem CID 44888324) has the molecular formula C30H23BF4O2 and a molecular weight of 502.32 g/mol. Its IUPAC name is 2,4-diphenyl-6-(2-phenylmethoxyphenyl)pyrylium tetrafluoroborate.
| Compound Name | 2,4-diphenyl-6-(2-phenylmethoxyphenyl)pyrylium tetrafluoroborate |
|---|---|
| PubChem CID | 44888324 |
| Molecular Formula | C30H23BF4O2 |
| Molecular Weight | 502.32 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 2,4-diphenyl-6-(2-phenylmethoxyphenyl)pyrylium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(COc2ccccc2-c2cc(-c3ccccc3)cc(-c3ccccc3)[o+]2)cc1 |
| InChI | InChI=1S/C30H23O2.BF4/c1-4-12-23(13-5-1)22-31-28-19-11-10-18-27(28)30-21-26(24-14-6-2-7-15-24)20-29(32-30)25-16-8-3-9-17-25;2-1(3,4)5/h1-21H,22H2;/q+1;-1 |
| InChIKey | PEEHMJHBMVCOBY-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.32 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|