C12H12N2OS2 — CID 45034877
(5Z)-1-methyl-3-prop-2-enyl-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one (PubChem CID 45034877) has the molecular formula C12H12N2OS2 and a molecular weight of 264.38 g/mol. Its IUPAC name is (5Z)-1-methyl-3-prop-2-enyl-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one.
| Compound Name | (5Z)-1-methyl-3-prop-2-enyl-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one |
|---|---|
| PubChem CID | 45034877 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (5Z)-1-methyl-3-prop-2-enyl-2-sulfanylidene-5-(thiophen-2-ylmethylidene)imidazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C/c2cccs2)N(C)C1=S |
| InChI | InChI=1S/C12H12N2OS2/c1-3-6-14-11(15)10(13(2)12(14)16)8-9-5-4-7-17-9/h3-5,7-8H,1,6H2,2H3/b10-8- |
| InChIKey | HFHMRQRPBZUPPH-NTMALXAHSA-N |
| XLogP | 2.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|