C18H30O7S — CID 45037075
6-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfanyl]hexanoic acid (PubChem CID 45037075) has the molecular formula C18H30O7S and a molecular weight of 390.50 g/mol. Its IUPAC name is 6-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfanyl]hexanoic acid.
| Compound Name | 6-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 45037075 |
| Molecular Formula | C18H30O7S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 6-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylsulfanyl]hexanoic acid |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CSCCCCCC(=O)O)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H30O7S/c1-17(2)22-13-11(10-26-9-7-5-6-8-12(19)20)21-16-15(14(13)23-17)24-18(3,4)25-16/h11,13-16H,5-10H2,1-4H3,(H,19,20)/t11-,13+,14+,15-,16-/m1/s1 |
| InChIKey | PFGOLRRELIQGFP-DZQJYWQESA-N |
| XLogP | 2.76 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|