C31H40N8O12S2 — CID 45049598
methyl hydrogen sulfate;7-nitro-4-[4-[3-[1-(7-nitroquinazolin-4-yl)piperidin-4-yl]propyl]piperidin-1-yl]quinazoline (PubChem CID 45049598) has the molecular formula C31H40N8O12S2 and a molecular weight of 780.84 g/mol. Its IUPAC name is methyl hydrogen sulfate;7-nitro-4-[4-[3-[1-(7-nitroquinazolin-4-yl)piperidin-4-yl]propyl]piperidin-1-yl]quinazoline.
| Compound Name | methyl hydrogen sulfate;7-nitro-4-[4-[3-[1-(7-nitroquinazolin-4-yl)piperidin-4-yl]propyl]piperidin-1-yl]quinazoline |
|---|---|
| PubChem CID | 45049598 |
| Molecular Formula | C31H40N8O12S2 |
| Molecular Weight | 780.84 g/mol |
| Exact Mass | 780.22 |
| IUPAC Name | methyl hydrogen sulfate;7-nitro-4-[4-[3-[1-(7-nitroquinazolin-4-yl)piperidin-4-yl]propyl]piperidin-1-yl]quinazoline |
| SMILES | COS(=O)(=O)O.COS(=O)(=O)O.O=[N+]([O-])c1ccc2c(N3CCC(CCCC4CCN(c5ncnc6cc([N+](=O)[O-])ccc56)CC4)CC3)ncnc2c1 |
| InChI | InChI=1S/C29H32N8O4.2CH4O4S/c38-36(39)22-4-6-24-26(16-22)30-18-32-28(24)34-12-8-20(9-13-34)2-1-3-21-10-14-35(15-11-21)29-25-7-5-23(37(40)41)17-27(25)31-19-33-29;2*1-5-6(2,3)4/h4-7,16-21H,1-3,8-15H2;2*1H3,(H,2,3,4) |
| InChIKey | NOQPDHHYYMHUFB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 271.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.84 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|