C33H24ClN5O2 — CID 4505031
N-[[1-[(4-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-2-(2-hydroxyphenyl)quinoline-4-carboxamide (PubChem CID 4505031) has the molecular formula C33H24ClN5O2 and a molecular weight of 558.04 g/mol. Its IUPAC name is N-[[1-[(4-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-2-(2-hydroxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[[1-[(4-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-2-(2-hydroxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4505031 |
| Molecular Formula | C33H24ClN5O2 |
| Molecular Weight | 558.04 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | N-[[1-[(4-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylideneamino]-2-(2-hydroxyphenyl)quinoline-4-carboxamide |
| SMILES | O=C(NN=Cc1cn(Cc2ccc(Cl)cc2)nc1-c1ccccc1)c1cc(-c2ccccc2O)nc2ccccc12 |
| InChI | InChI=1S/C33H24ClN5O2/c34-25-16-14-22(15-17-25)20-39-21-24(32(38-39)23-8-2-1-3-9-23)19-35-37-33(41)28-18-30(27-11-5-7-13-31(27)40)36-29-12-6-4-10-26(28)29/h1-19,21,40H,20H2,(H,37,41) |
| InChIKey | RAEQBOSDBSKKEY-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.04 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|