C7H11N3O — CID 45074587
N,N,5-trimethyl-1H-pyrazole-3-carboxamide (PubChem CID 45074587) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is N,N,5-trimethyl-1H-pyrazole-3-carboxamide.
| Compound Name | N,N,5-trimethyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 45074587 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | N,N,5-trimethyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C)n[nH]1 |
| InChI | InChI=1S/C7H11N3O/c1-5-4-6(9-8-5)7(11)10(2)3/h4H,1-3H3,(H,8,9) |
| InChIKey | WPOCPFGXSWKZGZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |