C19H23FN4O5 — CID 45076411
N-(4-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(5-methyl-1,2-oxazol-3-yl)butanediamide (PubChem CID 45076411) has the molecular formula C19H23FN4O5 and a molecular weight of 406.41 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(5-methyl-1,2-oxazol-3-yl)butanediamide.
| Compound Name | N-(4-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(5-methyl-1,2-oxazol-3-yl)butanediamide |
|---|---|
| PubChem CID | 45076411 |
| Molecular Formula | C19H23FN4O5 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-(4-fluorophenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-(5-methyl-1,2-oxazol-3-yl)butanediamide |
| SMILES | COCCNC(=O)CN(C(=O)CCC(=O)Nc1ccc(F)cc1)c1cc(C)on1 |
| InChI | InChI=1S/C19H23FN4O5/c1-13-11-16(23-29-13)24(12-18(26)21-9-10-28-2)19(27)8-7-17(25)22-15-5-3-14(20)4-6-15/h3-6,11H,7-10,12H2,1-2H3,(H,21,26)(H,22,25) |
| InChIKey | KZARXVYVYMECDE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|