C12H9N3 — CID 45077943
5,7,13-triazatetracyclo[9.3.1.02,10.04,8]pentadeca-1(14),2,4(8),5,9,11-hexaene (PubChem CID 45077943) has the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 5,7,13-triazatetracyclo[9.3.1.02,10.04,8]pentadeca-1(14),2,4(8),5,9,11-hexaene.
| Compound Name | 5,7,13-triazatetracyclo[9.3.1.02,10.04,8]pentadeca-1(14),2,4(8),5,9,11-hexaene |
|---|---|
| PubChem CID | 45077943 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 5,7,13-triazatetracyclo[9.3.1.02,10.04,8]pentadeca-1(14),2,4(8),5,9,11-hexaene |
| SMILES | C1=C2CC(=CN1)c1cc3[nH]cnc3cc12 |
| InChI | InChI=1S/C12H9N3/c1-7-4-13-5-8(1)10-3-12-11(2-9(7)10)14-6-15-12/h2-6,13H,1H2,(H,14,15) |
| InChIKey | AQTKKEDOJJTNJK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |