About 3H-pyrrolo[3,4-f]benzimidazol-7-one
3H-pyrrolo[3,4-f]benzimidazol-7-one (PubChem CID 143628134) has the molecular formula C9H5N3O
and a molecular weight of 171.16 g/mol. Its IUPAC name is 3H-pyrrolo[3,4-f]benzimidazol-7-one.
Molecular Properties
| Compound Name | 3H-pyrrolo[3,4-f]benzimidazol-7-one |
| PubChem CID | 143628134 |
| Molecular Formula | C9H5N3O |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 3H-pyrrolo[3,4-f]benzimidazol-7-one |
| SMILES | O=C1N=Cc2cc3[nH]cnc3cc21 |
| InChI | InChI=1S/C9H5N3O/c13-9-6-2-8-7(11-4-12-8)1-5(6)3-10-9/h1-4H,(H,11,12) |
| InChIKey | WJHYHTCYANRQOO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-pyrrolo[3,4-f]benzimidazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyrrolo[3,4-f]benzimidazol-7-one?
The IUPAC name of 3H-pyrrolo[3,4-f]benzimidazol-7-one (CID 143628134) is 3H-pyrrolo[3,4-f]benzimidazol-7-one.
What is the SMILES notation for 3H-pyrrolo[3,4-f]benzimidazol-7-one?
The canonical SMILES for 3H-pyrrolo[3,4-f]benzimidazol-7-one is O=C1N=Cc2cc3[nH]cnc3cc21.
What is the InChIKey of 3H-pyrrolo[3,4-f]benzimidazol-7-one?
The InChIKey is WJHYHTCYANRQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O/c13-9-6-2-8-7(11-4-12-8)1-5(6)3-10-9/h1-4H,(H,11,12).
What are the key properties of 3H-pyrrolo[3,4-f]benzimidazol-7-one?
3H-pyrrolo[3,4-f]benzimidazol-7-one has a molecular weight of 171.16 g/mol, XLogP of 1.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyrrolo[3,4-f]benzimidazol-7-one is sourced from PubChem (CID 143628134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).