C8H12O2 — CID 45079325
trans-(1S,2R)-2-ethoxy-1-ethynyl-1-methoxycyclopropane (PubChem CID 45079325) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is trans-(1S,2R)-2-ethoxy-1-ethynyl-1-methoxycyclopropane.
| Compound Name | trans-(1S,2R)-2-ethoxy-1-ethynyl-1-methoxycyclopropane |
|---|---|
| PubChem CID | 45079325 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | trans-(1S,2R)-2-ethoxy-1-ethynyl-1-methoxycyclopropane |
| SMILES | C#C[C@@]1(OC)C[C@H]1OCC |
| InChI | InChI=1S/C8H12O2/c1-4-8(9-3)6-7(8)10-5-2/h1,7H,5-6H2,2-3H3/t7-,8-/m1/s1 |
| InChIKey | RJCSJWCDROAWOQ-HTQZYQBOSA-N |
| XLogP | 0.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|