C11H20O2Si — CID 45094288
2-[(1R,2S)-2-ethoxy-1-methoxycyclopropyl]ethynyl-trimethylsilane (PubChem CID 45094288) has the molecular formula C11H20O2Si and a molecular weight of 212.36 g/mol. Its IUPAC name is 2-[(1R,2S)-2-ethoxy-1-methoxycyclopropyl]ethynyl-trimethylsilane.
| Compound Name | 2-[(1R,2S)-2-ethoxy-1-methoxycyclopropyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 45094288 |
| Molecular Formula | C11H20O2Si |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-[(1R,2S)-2-ethoxy-1-methoxycyclopropyl]ethynyl-trimethylsilane |
| SMILES | CCO[C@H]1C[C@]1(C#C[Si](C)(C)C)OC |
| InChI | InChI=1S/C11H20O2Si/c1-6-13-10-9-11(10,12-2)7-8-14(3,4)5/h10H,6,9H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | DFTPFAHZDJULNW-QWRGUYRKSA-N |
| XLogP | 2.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|