C25H42O3Si4 — CID 11005633
2-[2-ethoxy-4,5,5-tris(2-trimethylsilylethynyl)-1,3-dioxolan-4-yl]ethynyl-trimethylsilane (PubChem CID 11005633) has the molecular formula C25H42O3Si4 and a molecular weight of 502.95 g/mol. Its IUPAC name is 2-[2-ethoxy-4,5,5-tris(2-trimethylsilylethynyl)-1,3-dioxolan-4-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[2-ethoxy-4,5,5-tris(2-trimethylsilylethynyl)-1,3-dioxolan-4-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11005633 |
| Molecular Formula | C25H42O3Si4 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-[2-ethoxy-4,5,5-tris(2-trimethylsilylethynyl)-1,3-dioxolan-4-yl]ethynyl-trimethylsilane |
| SMILES | CCOC1OC(C#C[Si](C)(C)C)(C#C[Si](C)(C)C)C(C#C[Si](C)(C)C)(C#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C25H42O3Si4/c1-14-26-23-27-24(15-19-29(2,3)4,16-20-30(5,6)7)25(28-23,17-21-31(8,9)10)18-22-32(11,12)13/h23H,14H2,1-13H3 |
| InChIKey | MYXRENMMKIPNKF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|