C10H10O — CID 45082800
4-methyl-2-propa-1,2-dienylphenol (PubChem CID 45082800) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 4-methyl-2-propa-1,2-dienylphenol.
| Compound Name | 4-methyl-2-propa-1,2-dienylphenol |
|---|---|
| PubChem CID | 45082800 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 4-methyl-2-propa-1,2-dienylphenol |
| SMILES | C=C=Cc1cc(C)ccc1O |
| InChI | InChI=1S/C10H10O/c1-3-4-9-7-8(2)5-6-10(9)11/h4-7,11H,1H2,2H3 |
| InChIKey | VHJWDJOLVYKIQO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |