C10H11N — CID 45088044
spiro[3H-indolizine-2,1'-cyclopropane] (PubChem CID 45088044) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is spiro[3H-indolizine-2,1'-cyclopropane].
| Compound Name | spiro[3H-indolizine-2,1'-cyclopropane] |
|---|---|
| PubChem CID | 45088044 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | spiro[3H-indolizine-2,1'-cyclopropane] |
| SMILES | C1=CC2=CC3(CC3)CN2C=C1 |
| InChI | InChI=1S/C10H11N/c1-2-6-11-8-10(4-5-10)7-9(11)3-1/h1-3,6-7H,4-5,8H2 |
| InChIKey | MUQSLUIXULUXGR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |