C11H15N — CID 145142328
1,2,3a-trimethyl-4H-indole (PubChem CID 145142328) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 1,2,3a-trimethyl-4H-indole.
| Compound Name | 1,2,3a-trimethyl-4H-indole |
|---|---|
| PubChem CID | 145142328 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1,2,3a-trimethyl-4H-indole |
| SMILES | CC1=CC2(C)CC=CC=C2N1C |
| InChI | InChI=1S/C11H15N/c1-9-8-11(2)7-5-4-6-10(11)12(9)3/h4-6,8H,7H2,1-3H3 |
| InChIKey | OPNLYPQYOOHTDG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |