C9H10N- — CID 58039078
1-methyl-3,5-dihydro-2H-indol-5-ide (PubChem CID 58039078) has the molecular formula C9H10N- and a molecular weight of 132.19 g/mol. Its IUPAC name is 1-methyl-3,5-dihydro-2H-indol-5-ide.
| Compound Name | 1-methyl-3,5-dihydro-2H-indol-5-ide |
|---|---|
| PubChem CID | 58039078 |
| Molecular Formula | C9H10N- |
| Molecular Weight | 132.19 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 1-methyl-3,5-dihydro-2H-indol-5-ide |
| SMILES | CN1CCc2c[c-]ccc21 |
| InChI | InChI=1S/C9H10N/c1-10-7-6-8-4-2-3-5-9(8)10/h3-5H,6-7H2,1H3/q-1 |
| InChIKey | BRNRCEHNJPUSST-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|