C10H10NY- — CID 58541115
1-ethenyl-3,5-dihydro-2H-indol-5-ide;yttrium (PubChem CID 58541115) has the molecular formula C10H10NY- and a molecular weight of 233.10 g/mol. Its IUPAC name is 1-ethenyl-3,5-dihydro-2H-indol-5-ide;yttrium.
| Compound Name | 1-ethenyl-3,5-dihydro-2H-indol-5-ide;yttrium |
|---|---|
| PubChem CID | 58541115 |
| Molecular Formula | C10H10NY- |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | 1-ethenyl-3,5-dihydro-2H-indol-5-ide;yttrium |
| SMILES | C=CN1CCc2c[c-]ccc21.[Y] |
| InChI | InChI=1S/C10H10N.Y/c1-2-11-8-7-9-5-3-4-6-10(9)11;/h2,4-6H,1,7-8H2;/q-1; |
| InChIKey | SCXQLSREJVLCQB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|