C11H19NO2 — CID 45091892
tert-butyl-[(1S,2S)-1-ethenyl-2-methylcyclopropyl]carbamic acid (PubChem CID 45091892) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is tert-butyl-[(1S,2S)-1-ethenyl-2-methylcyclopropyl]carbamic acid.
| Compound Name | tert-butyl-[(1S,2S)-1-ethenyl-2-methylcyclopropyl]carbamic acid |
|---|---|
| PubChem CID | 45091892 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | tert-butyl-[(1S,2S)-1-ethenyl-2-methylcyclopropyl]carbamic acid |
| SMILES | C=C[C@@]1(N(C(=O)O)C(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C11H19NO2/c1-6-11(7-8(11)2)12(9(13)14)10(3,4)5/h6,8H,1,7H2,2-5H3,(H,13,14)/t8-,11+/m0/s1 |
| InChIKey | QACSYNYWPMTTEH-GZMMTYOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|