About [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid
[(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid (PubChem CID 69314557) has the molecular formula C7H13NO3
and a molecular weight of 159.19 g/mol. Its IUPAC name is [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid.
Molecular Properties
| Compound Name | [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid |
| PubChem CID | 69314557 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid |
| SMILES | C[C@@H]1C[C@@]1(CO)N(C)C(=O)O |
| InChI | InChI=1S/C7H13NO3/c1-5-3-7(5,4-9)8(2)6(10)11/h5,9H,3-4H2,1-2H3,(H,10,11)/t5-,7+/m1/s1 |
| InChIKey | LCAVXFAKIUIVBW-VDTYLAMSSA-N |
| XLogP | 0.37 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid?
The IUPAC name of [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid (CID 69314557) is [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid.
What is the SMILES notation for [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid?
The canonical SMILES for [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid is C[C@@H]1C[C@@]1(CO)N(C)C(=O)O.
What is the InChIKey of [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid?
The InChIKey is LCAVXFAKIUIVBW-VDTYLAMSSA-N. The full InChI is InChI=1S/C7H13NO3/c1-5-3-7(5,4-9)8(2)6(10)11/h5,9H,3-4H2,1-2H3,(H,10,11)/t5-,7+/m1/s1.
What are the key properties of [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid?
[(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid has a molecular weight of 159.19 g/mol, XLogP of 0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-1-(hydroxymethyl)-2-methylcyclopropyl]-methylcarbamic acid is sourced from PubChem (CID 69314557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).