C11H16N2O3 — CID 45093796
2-(3,4-dihydroxyphenyl)-2-hydroxy-N'-propan-2-ylethanimidamide (PubChem CID 45093796) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-2-hydroxy-N'-propan-2-ylethanimidamide.
| Compound Name | 2-(3,4-dihydroxyphenyl)-2-hydroxy-N'-propan-2-ylethanimidamide |
|---|---|
| PubChem CID | 45093796 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-2-hydroxy-N'-propan-2-ylethanimidamide |
| SMILES | CC(C)/N=C(\N)C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H16N2O3/c1-6(2)13-11(12)10(16)7-3-4-8(14)9(15)5-7/h3-6,10,14-16H,1-2H3,(H2,12,13) |
| InChIKey | CTJQOLHCQVFXSI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|