About 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one
5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one (PubChem CID 45098827) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one.
Analyze 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one?
The IUPAC name of 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one (CID 45098827) is 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one.
What is the SMILES notation for 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one?
The canonical SMILES for 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one is CC1(C)C2CCC13CCOC3(O)C2=O.
What is the InChIKey of 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one?
The InChIKey is RFCWGDQSKVFFBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-9(2)7-3-4-10(9)5-6-14-11(10,13)8(7)12/h7,13H,3-6H2,1-2H3.
What are the key properties of 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one?
5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one has a molecular weight of 196.25 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-10,10-dimethyl-4-oxatricyclo[5.2.1.01,5]decan-6-one is sourced from PubChem (CID 45098827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).