C19H28O4 — CID 45102528
[(E)-2-[(1S,2S,8S,8aS)-2-acetyloxy-8,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl]prop-1-enyl] acetate (PubChem CID 45102528) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is [(E)-2-[(1S,2S,8S,8aS)-2-acetyloxy-8,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl]prop-1-enyl] acetate.
| Compound Name | [(E)-2-[(1S,2S,8S,8aS)-2-acetyloxy-8,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl]prop-1-enyl] acetate |
|---|---|
| PubChem CID | 45102528 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [(E)-2-[(1S,2S,8S,8aS)-2-acetyloxy-8,8a-dimethyl-2,3,5,6,7,8-hexahydro-1H-naphthalen-1-yl]prop-1-enyl] acetate |
| SMILES | CC(=O)O/C=C(\C)[C@H]1[C@@H](OC(C)=O)CC=C2CCC[C@H](C)[C@]21C |
| InChI | InChI=1S/C19H28O4/c1-12(11-22-14(3)20)18-17(23-15(4)21)10-9-16-8-6-7-13(2)19(16,18)5/h9,11,13,17-18H,6-8,10H2,1-5H3/b12-11+/t13-,17-,18-,19+/m0/s1 |
| InChIKey | JOLPOPTXXUNHQE-FJYZZUQMSA-N |
| XLogP | 4.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|