C15H13BrN4 — CID 45103445
7-bromo-N-(2-phenylethyl)-1,2,4-benzotriazin-3-amine (PubChem CID 45103445) has the molecular formula C15H13BrN4 and a molecular weight of 329.20 g/mol. Its IUPAC name is 7-bromo-N-(2-phenylethyl)-1,2,4-benzotriazin-3-amine.
| Compound Name | 7-bromo-N-(2-phenylethyl)-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 45103445 |
| Molecular Formula | C15H13BrN4 |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 7-bromo-N-(2-phenylethyl)-1,2,4-benzotriazin-3-amine |
| SMILES | Brc1ccc2nc(NCCc3ccccc3)nnc2c1 |
| InChI | InChI=1S/C15H13BrN4/c16-12-6-7-13-14(10-12)19-20-15(18-13)17-9-8-11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,17,18,20) |
| InChIKey | XTEHSDICOBKSSF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |