About 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide
3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide (PubChem CID 45108675) has the molecular formula C14H11BrFN2S-
and a molecular weight of 338.23 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide.
Molecular Properties
| Compound Name | 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide |
| PubChem CID | 45108675 |
| Molecular Formula | C14H11BrFN2S- |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide |
| SMILES | Fc1cccc(CSc2ncc3ccccn23)c1.[Br-] |
| InChI | InChI=1S/C14H11FN2S.BrH/c15-12-5-3-4-11(8-12)10-18-14-16-9-13-6-1-2-7-17(13)14;/h1-9H,10H2;1H/p-1 |
| InChIKey | GDVPMCWJBRZEPJ-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide?
The IUPAC name of 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide (CID 45108675) is 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide.
What is the SMILES notation for 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide?
The canonical SMILES for 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide is Fc1cccc(CSc2ncc3ccccn23)c1.[Br-].
What is the InChIKey of 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide?
The InChIKey is GDVPMCWJBRZEPJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H11FN2S.BrH/c15-12-5-3-4-11(8-12)10-18-14-16-9-13-6-1-2-7-17(13)14;/h1-9H,10H2;1H/p-1.
What are the key properties of 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide?
3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide has a molecular weight of 338.23 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-fluorophenyl)methylsulfanyl]imidazo[1,5-a]pyridine bromide is sourced from PubChem (CID 45108675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).