C15H10F2N2O3 — CID 45109198
N-[(E)-1,3-benzodioxol-4-ylmethylideneamino]-2,6-difluorobenzamide (PubChem CID 45109198) has the molecular formula C15H10F2N2O3 and a molecular weight of 304.25 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-4-ylmethylideneamino]-2,6-difluorobenzamide.
| Compound Name | N-[(E)-1,3-benzodioxol-4-ylmethylideneamino]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 45109198 |
| Molecular Formula | C15H10F2N2O3 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-4-ylmethylideneamino]-2,6-difluorobenzamide |
| SMILES | O=C(N/N=C/c1cccc2c1OCO2)c1c(F)cccc1F |
| InChI | InChI=1S/C15H10F2N2O3/c16-10-4-2-5-11(17)13(10)15(20)19-18-7-9-3-1-6-12-14(9)22-8-21-12/h1-7H,8H2,(H,19,20)/b18-7+ |
| InChIKey | ASINPNVRBILCDH-CNHKJKLMSA-N |
| XLogP | 2.46 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|