C14H12N2O3S — CID 45109154
N-[(E)-1,3-benzodioxol-4-ylmethylideneamino]-5-methylthiophene-2-carboxamide (PubChem CID 45109154) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-4-ylmethylideneamino]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[(E)-1,3-benzodioxol-4-ylmethylideneamino]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 45109154 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-4-ylmethylideneamino]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N/N=C/c2cccc3c2OCO3)s1 |
| InChI | InChI=1S/C14H12N2O3S/c1-9-5-6-12(20-9)14(17)16-15-7-10-3-2-4-11-13(10)19-8-18-11/h2-7H,8H2,1H3,(H,16,17)/b15-7+ |
| InChIKey | KTIAJLDJHMXUAG-VIZOYTHASA-N |
| XLogP | 2.55 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|