C26H37NO6S2Si — CID 45113491
(6R)-5,5-bis(benzenesulfonyl)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-2-one (PubChem CID 45113491) has the molecular formula C26H37NO6S2Si and a molecular weight of 551.80 g/mol. Its IUPAC name is (6R)-5,5-bis(benzenesulfonyl)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-2-one.
| Compound Name | (6R)-5,5-bis(benzenesulfonyl)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-2-one |
|---|---|
| PubChem CID | 45113491 |
| Molecular Formula | C26H37NO6S2Si |
| Molecular Weight | 551.80 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | (6R)-5,5-bis(benzenesulfonyl)-6-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-2-one |
| SMILES | CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CCC1(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H37NO6S2Si/c1-7-22(33-36(5,6)25(2,3)4)24-26(19-18-23(28)27-24,34(29,30)20-14-10-8-11-15-20)35(31,32)21-16-12-9-13-17-21/h8-17,22,24H,7,18-19H2,1-6H3,(H,27,28)/t22-,24+/m0/s1 |
| InChIKey | OHUHCXHKHGUXEO-LADGPHEKSA-N |
| XLogP | 4.71 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.80 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|